ClownCLod ClownCLod

24-05-2021
Mathematics

contestada

Simplify the expression by combining like terms.

16+8−3+6−9

Pls help

Simplify the expression by combining like terms 168369 Pls help class=

Respuesta :

Halimi204156 Halimi204156

24-05-2021

Answer:

5a + 6b + 7

step-by-step explanation:

16 + 8a -3a + 6a -9: subtract 9 from 16

7 + 8a -3a + 6b Now subtract -3a from 8a

5a + 6b + 7 is the final answer.

Answer Link

Otras preguntas

For school, we have to write a poem based on the events of the civil rights period. Can somebody give me a few ideas or facts on what to write? It can be anyth

For an employee training, the employee to instructor ratio is 24 to 2. If there are 21 instructors for the training, how many employees participated in the trai

What is the difference between an exergonic reaction and an endergonic reaction

What can happen if your body lacked neurotransmitters?

What effects would an occluded front have on an area of farmland that has been experiencing drought conditions? gray skies, but no rain an extended period of r

Which document expresses that people are entitled to the free exercise of religion?

happiness honour courage serenity are what noun

Give as many names as you can think of that are in theaters and are for kids/teens/pre-teens. Give A LOT! The person to give the most movies, gets a brainliest

Describe the function of the male reproductive system.

Blance this out please! Ba(CN)2+2H2SO4=BaSO4+2HCN