coolgirllol890 coolgirllol890

26-01-2020
Social Studies

contestada

The author of this editorial supports his argument's validity

Respuesta :

davidthompson21 davidthompson21

04-02-2020

Answer:

its D. the one with ''by demonstrating''

Explanation:

just took the test

Answer Link

Otras preguntas

Marco had 21 party favors. He put them into 7 bags with the same number in each bag. How many party favors were in each bag?

Use the figure to find the measures of the numbered angles. a 107 b mm

According to Islamic belief, how did Muhammad get the ideas that started Islam?

What is the probability that each of the following pairs of parents will produce the indicated offsprings? (assume independent assortment of all gene pairs)a)CC

3. What does he mean by "wee must Consider that wee shall be as a City upon a Hill?

Which of the following is the correct structure of 2-methyl-3-heptenea. CH3-CH2-C(CH3)=CH-CH2-CH2-CH3b. CH3-CH2CH=CH-CH2CH(CH3)-CH3c. CH3-CH2-CH=CH-CH-(CH3)-CH2

A fruit basket is filled with 888 bananas, 333 oranges, 555 apples, and 666 kiwis. For every 333 kiwis, there are 444 \_\_\_\_____\_, \_, \_, \_. Choose 1 answe

can someone please help me with this question, ill give brainiest.

Solve the quadratic equation x2−5x=−20 by completing the square.

What causes the different seasons on Earth?